Molecule Detail

Aminobenzoic acid

Chemical Information

Formula: H2NC6H4CO2H

Inchi: InChI=1S/C7H7NO2/c8-6-3-1-5(2-4-6)7(9)10/h1-4H,8H2,(H,9,10)

Exact mass: 137.04767846

Solubility: less water souble

External reference numbers

ChEBI:

lipidMAPS:

CAS:

Pubchem: 7057990

HMDB:

Tags

Standard: 58: Aminobenzoic acid