Standard Detail: Aminobenzoic acid

Chemical Information

Name Aminobenzoic acid
Formula H2NC6H4CO2H
Inventory ID 58
Exact mass 137.04767846
Solubility less water souble
Inchi InChI=1S/C7H7NO2/c8-6-3-1-5(2-4-6)7(9)10/h1-4H,8H2,(H,9,10)

External reference numbers

ChEBI
lipidMAPS
CAS
Pubchem 7057990
Vendor Sigma
Vendor Catalogue Number A9878